C16H16F3N3O2 — CID 155969626
1-[(6-ethoxy-3-pyridinyl)methyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 155969626) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is 1-[(6-ethoxy-3-pyridinyl)methyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(6-ethoxy-3-pyridinyl)methyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 155969626 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-[(6-ethoxy-3-pyridinyl)methyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CCOc1ccc(CNC(=O)Nc2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C16H16F3N3O2/c1-2-24-14-8-3-11(9-20-14)10-21-15(23)22-13-6-4-12(5-7-13)16(17,18)19/h3-9H,2,10H2,1H3,(H2,21,22,23) |
| InChIKey | UKKSNSVGFGIQQJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |