C13H22O7S — CID 130274775
(2S)-4-(cyclohexylmethyl)-5-methoxy-5-oxo-2-sulfopentanoic acid (PubChem CID 130274775) has the molecular formula C13H22O7S and a molecular weight of 322.38 g/mol. Its IUPAC name is (2S)-4-(cyclohexylmethyl)-5-methoxy-5-oxo-2-sulfopentanoic acid.
| Compound Name | (2S)-4-(cyclohexylmethyl)-5-methoxy-5-oxo-2-sulfopentanoic acid |
|---|---|
| PubChem CID | 130274775 |
| Molecular Formula | C13H22O7S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (2S)-4-(cyclohexylmethyl)-5-methoxy-5-oxo-2-sulfopentanoic acid |
| SMILES | COC(=O)C(CC1CCCCC1)C[C@@H](C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C13H22O7S/c1-20-13(16)10(7-9-5-3-2-4-6-9)8-11(12(14)15)21(17,18)19/h9-11H,2-8H2,1H3,(H,14,15)(H,17,18,19)/t10?,11-/m0/s1 |
| InChIKey | UOWYUJWNMSIEJA-DTIOYNMSSA-N |
| XLogP | 1.48 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|