C10H8O4S — CID 130274825
2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid (PubChem CID 130274825) has the molecular formula C10H8O4S and a molecular weight of 224.24 g/mol. Its IUPAC name is 2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid.
| Compound Name | 2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid |
|---|---|
| PubChem CID | 130274825 |
| Molecular Formula | C10H8O4S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid |
| SMILES | O=C(O)Cc1csc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C10H8O4S/c11-6-2-7(12)10-5(1-9(13)14)4-15-8(10)3-6/h2-4,11-12H,1H2,(H,13,14) |
| InChIKey | SEWBYJSYHZEWCG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |