2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid

C10H8O4S — CID 130274825

IUPAC2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid
SMILESO=C(O)Cc1csc2cc(O)cc(O)c12
InChIInChI=1S/C10H8O4S/c11-6-2-7(12)10-5(1-9(13)14)4-15-8(10)3-6/h2-4,11-12H,1H2,(H,13,14)
InChIKeySEWBYJSYHZEWCG-UHFFFAOYSA-N
MW224.24 g/mol
LogP1.94
Rot. Bonds2

About 2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid

2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid (PubChem CID 130274825) has the molecular formula C10H8O4S and a molecular weight of 224.24 g/mol. Its IUPAC name is 2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid.

Molecular Properties

Compound Name2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid
PubChem CID130274825
Molecular FormulaC10H8O4S
Molecular Weight224.24 g/mol
Exact Mass224.01
IUPAC Name2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid
SMILESO=C(O)Cc1csc2cc(O)cc(O)c12
InChIInChI=1S/C10H8O4S/c11-6-2-7(12)10-5(1-9(13)14)4-15-8(10)3-6/h2-4,11-12H,1H2,(H,13,14)
InChIKeySEWBYJSYHZEWCG-UHFFFAOYSA-N
XLogP1.94
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.24
LogP ≤ 51.94
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid?
The IUPAC name of 2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid (CID 130274825) is 2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid.
What is the SMILES notation for 2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid?
The canonical SMILES for 2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid is O=C(O)Cc1csc2cc(O)cc(O)c12.
What is the InChIKey of 2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid?
The InChIKey is SEWBYJSYHZEWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O4S/c11-6-2-7(12)10-5(1-9(13)14)4-15-8(10)3-6/h2-4,11-12H,1H2,(H,13,14).
What are the key properties of 2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid?
2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid has a molecular weight of 224.24 g/mol, XLogP of 1.94, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid is sourced from PubChem (CID 130274825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).