2-(4-hydroxythiophen-2-yl)acetic acid

C6H6O3S — CID 119087803

IUPAC2-(4-hydroxythiophen-2-yl)acetic acid
SMILESO=C(O)Cc1cc(O)cs1
InChIInChI=1S/C6H6O3S/c7-4-1-5(10-3-4)2-6(8)9/h1,3,7H,2H2,(H,8,9)
InChIKeyYOZDDPCPIPOTKG-UHFFFAOYSA-N
MW158.18 g/mol
LogP1.08
Rot. Bonds2

About 2-(4-hydroxythiophen-2-yl)acetic acid

2-(4-hydroxythiophen-2-yl)acetic acid (PubChem CID 119087803) has the molecular formula C6H6O3S and a molecular weight of 158.18 g/mol. Its IUPAC name is 2-(4-hydroxythiophen-2-yl)acetic acid.

Molecular Properties

Compound Name2-(4-hydroxythiophen-2-yl)acetic acid
PubChem CID119087803
Molecular FormulaC6H6O3S
Molecular Weight158.18 g/mol
Exact Mass158.00
IUPAC Name2-(4-hydroxythiophen-2-yl)acetic acid
SMILESO=C(O)Cc1cc(O)cs1
InChIInChI=1S/C6H6O3S/c7-4-1-5(10-3-4)2-6(8)9/h1,3,7H,2H2,(H,8,9)
InChIKeyYOZDDPCPIPOTKG-UHFFFAOYSA-N
XLogP1.08
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.18
LogP ≤ 51.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}

Analyze 2-(4-hydroxythiophen-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(4-nitrothiophen-2-yl)acetic acid
CID 82405574
2-[4-(4-oxobut-1-enyl)thiophen-2-yl]acetic acid
CID 170481695
2-[4-(3-bromo-1,2-dihydroxypropyl)thiophen-2-yl]acetic acid
CID 171859834
2-(4,6-dihydroxy-1-benzothiophen-3-yl)acetic acid
CID 130274825
2-(5-hydroxy-1-benzothiophen-3-yl)acetic acid
CID 27808
2-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]thiophen-2-yl]acetic acid
CID 23330347
2-[[2-(4-bromothiophen-2-yl)acetyl]amino]acetic acid
CID 82307146
benzene;methane;2-thiophen-2-ylacetic acid
CID 70426530
2-(5-tert-butylthiophen-3-yl)acetic acid
CID 139570446
2-[4-(4-azido-1,2-dihydroxybutyl)thiophen-2-yl]acetic acid
CID 171879317
2-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-enyl]thiophen-2-yl]acetic acid
CID 169467331
2-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophen-2-yl]acetic acid
CID 170802919

Frequently Asked Questions

What is the IUPAC name of 2-(4-hydroxythiophen-2-yl)acetic acid?
The IUPAC name of 2-(4-hydroxythiophen-2-yl)acetic acid (CID 119087803) is 2-(4-hydroxythiophen-2-yl)acetic acid.
What is the SMILES notation for 2-(4-hydroxythiophen-2-yl)acetic acid?
The canonical SMILES for 2-(4-hydroxythiophen-2-yl)acetic acid is O=C(O)Cc1cc(O)cs1.
What is the InChIKey of 2-(4-hydroxythiophen-2-yl)acetic acid?
The InChIKey is YOZDDPCPIPOTKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3S/c7-4-1-5(10-3-4)2-6(8)9/h1,3,7H,2H2,(H,8,9).
What are the key properties of 2-(4-hydroxythiophen-2-yl)acetic acid?
2-(4-hydroxythiophen-2-yl)acetic acid has a molecular weight of 158.18 g/mol, XLogP of 1.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxythiophen-2-yl)acetic acid is sourced from PubChem (CID 119087803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).