C10H10O3S — CID 170481695
2-[4-(4-oxobut-1-enyl)thiophen-2-yl]acetic acid (PubChem CID 170481695) has the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. Its IUPAC name is 2-[4-(4-oxobut-1-enyl)thiophen-2-yl]acetic acid.
| Compound Name | 2-[4-(4-oxobut-1-enyl)thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 170481695 |
| Molecular Formula | C10H10O3S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 2-[4-(4-oxobut-1-enyl)thiophen-2-yl]acetic acid |
| SMILES | O=CCC=Cc1csc(CC(=O)O)c1 |
| InChI | InChI=1S/C10H10O3S/c11-4-2-1-3-8-5-9(14-7-8)6-10(12)13/h1,3-5,7H,2,6H2,(H,12,13) |
| InChIKey | AVAPGDOEBCOSBR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|