C10H12O2S2 — CID 169456613
S-[3-[5-(hydroxymethyl)thiophen-3-yl]prop-2-enyl] ethanethioate (PubChem CID 169456613) has the molecular formula C10H12O2S2 and a molecular weight of 228.34 g/mol. Its IUPAC name is S-[3-[5-(hydroxymethyl)thiophen-3-yl]prop-2-enyl] ethanethioate.
| Compound Name | S-[3-[5-(hydroxymethyl)thiophen-3-yl]prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169456613 |
| Molecular Formula | C10H12O2S2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | S-[3-[5-(hydroxymethyl)thiophen-3-yl]prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC=Cc1csc(CO)c1 |
| InChI | InChI=1S/C10H12O2S2/c1-8(12)13-4-2-3-9-5-10(6-11)14-7-9/h2-3,5,7,11H,4,6H2,1H3 |
| InChIKey | YPESCYGBTAMLOJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|