C9H11NO2S2 — CID 169456684
S-[3-[4-(hydroxymethyl)-1,3-thiazol-2-yl]prop-2-enyl] ethanethioate (PubChem CID 169456684) has the molecular formula C9H11NO2S2 and a molecular weight of 229.33 g/mol. Its IUPAC name is S-[3-[4-(hydroxymethyl)-1,3-thiazol-2-yl]prop-2-enyl] ethanethioate.
| Compound Name | S-[3-[4-(hydroxymethyl)-1,3-thiazol-2-yl]prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169456684 |
| Molecular Formula | C9H11NO2S2 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | S-[3-[4-(hydroxymethyl)-1,3-thiazol-2-yl]prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC=Cc1nc(CO)cs1 |
| InChI | InChI=1S/C9H11NO2S2/c1-7(12)13-4-2-3-9-10-8(5-11)6-14-9/h2-3,6,11H,4-5H2,1H3 |
| InChIKey | ONIWEKKQOTVRAM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|