C10H10F3NOS2 — CID 170480154
S-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]but-3-enyl] ethanethioate (PubChem CID 170480154) has the molecular formula C10H10F3NOS2 and a molecular weight of 281.32 g/mol. Its IUPAC name is S-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]but-3-enyl] ethanethioate.
| Compound Name | S-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480154 |
| Molecular Formula | C10H10F3NOS2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | S-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C10H10F3NOS2/c1-7(15)16-5-3-2-4-9-14-8(6-17-9)10(11,12)13/h2,4,6H,3,5H2,1H3 |
| InChIKey | XKZCVSQFMIHRRW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|