C12H16N2OS — CID 170479745
S-[4-(6-amino-2-methyl-3-pyridinyl)but-3-enyl] ethanethioate (PubChem CID 170479745) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is S-[4-(6-amino-2-methyl-3-pyridinyl)but-3-enyl] ethanethioate.
| Compound Name | S-[4-(6-amino-2-methyl-3-pyridinyl)but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170479745 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | S-[4-(6-amino-2-methyl-3-pyridinyl)but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1ccc(N)nc1C |
| InChI | InChI=1S/C12H16N2OS/c1-9-11(6-7-12(13)14-9)5-3-4-8-16-10(2)15/h3,5-7H,4,8H2,1-2H3,(H2,13,14) |
| InChIKey | FFMYKYYJDYDBLE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|