C10H11NO3S2 — CID 169457270
methyl 2-(3-acetylsulfanylprop-1-enyl)-1,3-thiazole-4-carboxylate (PubChem CID 169457270) has the molecular formula C10H11NO3S2 and a molecular weight of 257.34 g/mol. Its IUPAC name is methyl 2-(3-acetylsulfanylprop-1-enyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(3-acetylsulfanylprop-1-enyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 169457270 |
| Molecular Formula | C10H11NO3S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | methyl 2-(3-acetylsulfanylprop-1-enyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(C=CCSC(C)=O)n1 |
| InChI | InChI=1S/C10H11NO3S2/c1-7(12)15-5-3-4-9-11-8(6-16-9)10(13)14-2/h3-4,6H,5H2,1-2H3 |
| InChIKey | LBTXSZSAILXLFE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|