C11H13N3O3S — CID 169457903
methyl 6-(3-acetylsulfanylprop-1-enyl)-3-aminopyrazine-2-carboxylate (PubChem CID 169457903) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is methyl 6-(3-acetylsulfanylprop-1-enyl)-3-aminopyrazine-2-carboxylate.
| Compound Name | methyl 6-(3-acetylsulfanylprop-1-enyl)-3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 169457903 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | methyl 6-(3-acetylsulfanylprop-1-enyl)-3-aminopyrazine-2-carboxylate |
| SMILES | COC(=O)c1nc(C=CCSC(C)=O)cnc1N |
| InChI | InChI=1S/C11H13N3O3S/c1-7(15)18-5-3-4-8-6-13-10(12)9(14-8)11(16)17-2/h3-4,6H,5H2,1-2H3,(H2,12,13) |
| InChIKey | RBLQBJNJQKVZFB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|