C10H12N4O3 — CID 170798601
methyl 3-amino-6-(4-amino-4-oxobut-1-enyl)pyrazine-2-carboxylate (PubChem CID 170798601) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is methyl 3-amino-6-(4-amino-4-oxobut-1-enyl)pyrazine-2-carboxylate.
| Compound Name | methyl 3-amino-6-(4-amino-4-oxobut-1-enyl)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 170798601 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | methyl 3-amino-6-(4-amino-4-oxobut-1-enyl)pyrazine-2-carboxylate |
| SMILES | COC(=O)c1nc(C=CCC(N)=O)cnc1N |
| InChI | InChI=1S/C10H12N4O3/c1-17-10(16)8-9(12)13-5-6(14-8)3-2-4-7(11)15/h2-3,5H,4H2,1H3,(H2,11,15)(H2,12,13) |
| InChIKey | QEAGIIIZHILQKP-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |