C9H10ClNO2S — CID 170499206
methyl 2-(4-chlorobut-1-enyl)-1,3-thiazole-4-carboxylate (PubChem CID 170499206) has the molecular formula C9H10ClNO2S and a molecular weight of 231.70 g/mol. Its IUPAC name is methyl 2-(4-chlorobut-1-enyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(4-chlorobut-1-enyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 170499206 |
| Molecular Formula | C9H10ClNO2S |
| Molecular Weight | 231.70 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | methyl 2-(4-chlorobut-1-enyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(C=CCCCl)n1 |
| InChI | InChI=1S/C9H10ClNO2S/c1-13-9(12)7-6-14-8(11-7)4-2-3-5-10/h2,4,6H,3,5H2,1H3 |
| InChIKey | BSGYSTKOKTWCRF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.70 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|