C8H8ClNOS — CID 170498657
4-(4-chlorobut-1-enyl)-1,3-thiazole-2-carbaldehyde (PubChem CID 170498657) has the molecular formula C8H8ClNOS and a molecular weight of 201.68 g/mol. Its IUPAC name is 4-(4-chlorobut-1-enyl)-1,3-thiazole-2-carbaldehyde.
| Compound Name | 4-(4-chlorobut-1-enyl)-1,3-thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 170498657 |
| Molecular Formula | C8H8ClNOS |
| Molecular Weight | 201.68 g/mol |
| Exact Mass | 201.00 |
| IUPAC Name | 4-(4-chlorobut-1-enyl)-1,3-thiazole-2-carbaldehyde |
| SMILES | O=Cc1nc(C=CCCCl)cs1 |
| InChI | InChI=1S/C8H8ClNOS/c9-4-2-1-3-7-6-12-8(5-11)10-7/h1,3,5-6H,2,4H2 |
| InChIKey | RDULNILZPSJMBA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.68 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|