C11H15ClN2OS — CID 170499858
4-[4-(4-chlorobut-1-enyl)-1,3-thiazol-2-yl]morpholine (PubChem CID 170499858) has the molecular formula C11H15ClN2OS and a molecular weight of 258.77 g/mol. Its IUPAC name is 4-[4-(4-chlorobut-1-enyl)-1,3-thiazol-2-yl]morpholine.
| Compound Name | 4-[4-(4-chlorobut-1-enyl)-1,3-thiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 170499858 |
| Molecular Formula | C11H15ClN2OS |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 4-[4-(4-chlorobut-1-enyl)-1,3-thiazol-2-yl]morpholine |
| SMILES | ClCCC=Cc1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H15ClN2OS/c12-4-2-1-3-10-9-16-11(13-10)14-5-7-15-8-6-14/h1,3,9H,2,4-8H2 |
| InChIKey | RBCXKPRLLBIGNQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|