C10H10I2N4OS — CID 118710795
4-[4-(4,5-diiodoimidazol-1-yl)-1,3-thiazol-2-yl]morpholine (PubChem CID 118710795) has the molecular formula C10H10I2N4OS and a molecular weight of 488.09 g/mol. Its IUPAC name is 4-[4-(4,5-diiodoimidazol-1-yl)-1,3-thiazol-2-yl]morpholine.
| Compound Name | 4-[4-(4,5-diiodoimidazol-1-yl)-1,3-thiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 118710795 |
| Molecular Formula | C10H10I2N4OS |
| Molecular Weight | 488.09 g/mol |
| Exact Mass | 487.87 |
| IUPAC Name | 4-[4-(4,5-diiodoimidazol-1-yl)-1,3-thiazol-2-yl]morpholine |
| SMILES | Ic1ncn(-c2csc(N3CCOCC3)n2)c1I |
| InChI | InChI=1S/C10H10I2N4OS/c11-8-9(12)16(6-13-8)7-5-18-10(14-7)15-1-3-17-4-2-15/h5-6H,1-4H2 |
| InChIKey | RTVWYYGYVBAFBZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.09 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|