C7H11BN2O3S — CID 66632378
(2-morpholin-4-yl-1,3-thiazol-4-yl)boronic acid (PubChem CID 66632378) has the molecular formula C7H11BN2O3S and a molecular weight of 214.05 g/mol. Its IUPAC name is (2-morpholin-4-yl-1,3-thiazol-4-yl)boronic acid.
| Compound Name | (2-morpholin-4-yl-1,3-thiazol-4-yl)boronic acid |
|---|---|
| PubChem CID | 66632378 |
| Molecular Formula | C7H11BN2O3S |
| Molecular Weight | 214.05 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | (2-morpholin-4-yl-1,3-thiazol-4-yl)boronic acid |
| SMILES | OB(O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C7H11BN2O3S/c11-8(12)6-5-14-7(9-6)10-1-3-13-4-2-10/h5,11-12H,1-4H2 |
| InChIKey | JBFVMPFBBNVHLP-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.05 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|