C11H17N3O4S — CID 171899934
3,4-dihydroxy-4-(2-morpholin-4-yl-1,3-thiazol-4-yl)butanamide (PubChem CID 171899934) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(2-morpholin-4-yl-1,3-thiazol-4-yl)butanamide.
| Compound Name | 3,4-dihydroxy-4-(2-morpholin-4-yl-1,3-thiazol-4-yl)butanamide |
|---|---|
| PubChem CID | 171899934 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3,4-dihydroxy-4-(2-morpholin-4-yl-1,3-thiazol-4-yl)butanamide |
| SMILES | NC(=O)CC(O)C(O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H17N3O4S/c12-9(16)5-8(15)10(17)7-6-19-11(13-7)14-1-3-18-4-2-14/h6,8,10,15,17H,1-5H2,(H2,12,16) |
| InChIKey | DQKWQRIIJODQEV-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |