C12H19N3O2S — CID 114275536
4-(2-morpholin-4-yl-1,3-thiazol-4-yl)oxan-4-amine (PubChem CID 114275536) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-(2-morpholin-4-yl-1,3-thiazol-4-yl)oxan-4-amine.
| Compound Name | 4-(2-morpholin-4-yl-1,3-thiazol-4-yl)oxan-4-amine |
|---|---|
| PubChem CID | 114275536 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-(2-morpholin-4-yl-1,3-thiazol-4-yl)oxan-4-amine |
| SMILES | NC1(c2csc(N3CCOCC3)n2)CCOCC1 |
| InChI | InChI=1S/C12H19N3O2S/c13-12(1-5-16-6-2-12)10-9-18-11(14-10)15-3-7-17-8-4-15/h9H,1-8,13H2 |
| InChIKey | NSZSPDNAHXDEIE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |