C14H24N2OS — CID 114212216
4-[2-(3,3-dimethylbutyl)-1,3-thiazol-4-yl]oxan-4-amine (PubChem CID 114212216) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 4-[2-(3,3-dimethylbutyl)-1,3-thiazol-4-yl]oxan-4-amine.
| Compound Name | 4-[2-(3,3-dimethylbutyl)-1,3-thiazol-4-yl]oxan-4-amine |
|---|---|
| PubChem CID | 114212216 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 4-[2-(3,3-dimethylbutyl)-1,3-thiazol-4-yl]oxan-4-amine |
| SMILES | CC(C)(C)CCc1nc(C2(N)CCOCC2)cs1 |
| InChI | InChI=1S/C14H24N2OS/c1-13(2,3)5-4-12-16-11(10-18-12)14(15)6-8-17-9-7-14/h10H,4-9,15H2,1-3H3 |
| InChIKey | YYSOKHRAKJKFTA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |