C15H19N3OS — CID 167513347
2,3-dimethyl-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)aniline (PubChem CID 167513347) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 2,3-dimethyl-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)aniline.
| Compound Name | 2,3-dimethyl-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)aniline |
|---|---|
| PubChem CID | 167513347 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2,3-dimethyl-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)aniline |
| SMILES | Cc1ccc(-c2csc(N3CCOCC3)n2)c(N)c1C |
| InChI | InChI=1S/C15H19N3OS/c1-10-3-4-12(14(16)11(10)2)13-9-20-15(17-13)18-5-7-19-8-6-18/h3-4,9H,5-8,16H2,1-2H3 |
| InChIKey | YTIFONYULWXVNX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|