C11H17ClN2O3S — CID 171894560
4-chloro-1-(2-morpholin-4-yl-1,3-thiazol-4-yl)butane-1,2-diol (PubChem CID 171894560) has the molecular formula C11H17ClN2O3S and a molecular weight of 292.79 g/mol. Its IUPAC name is 4-chloro-1-(2-morpholin-4-yl-1,3-thiazol-4-yl)butane-1,2-diol.
| Compound Name | 4-chloro-1-(2-morpholin-4-yl-1,3-thiazol-4-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171894560 |
| Molecular Formula | C11H17ClN2O3S |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 4-chloro-1-(2-morpholin-4-yl-1,3-thiazol-4-yl)butane-1,2-diol |
| SMILES | OC(CCCl)C(O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H17ClN2O3S/c12-2-1-9(15)10(16)8-7-18-11(13-8)14-3-5-17-6-4-14/h7,9-10,15-16H,1-6H2 |
| InChIKey | QPKXDPJKJMMVNB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|