C11H11N3OS — CID 170475542
4-(2-morpholin-4-yl-1,3-thiazol-4-yl)but-3-ynenitrile (PubChem CID 170475542) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 4-(2-morpholin-4-yl-1,3-thiazol-4-yl)but-3-ynenitrile.
| Compound Name | 4-(2-morpholin-4-yl-1,3-thiazol-4-yl)but-3-ynenitrile |
|---|---|
| PubChem CID | 170475542 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 4-(2-morpholin-4-yl-1,3-thiazol-4-yl)but-3-ynenitrile |
| SMILES | N#CCC#Cc1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H11N3OS/c12-4-2-1-3-10-9-16-11(13-10)14-5-7-15-8-6-14/h9H,2,5-8H2 |
| InChIKey | DBVLHSAFKDHOKD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|