C14H19N5O2S — CID 138379964
5-ethyl-3-(2-morpholin-4-yl-1,3-thiazol-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazine (PubChem CID 138379964) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is 5-ethyl-3-(2-morpholin-4-yl-1,3-thiazol-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazine.
| Compound Name | 5-ethyl-3-(2-morpholin-4-yl-1,3-thiazol-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazine |
|---|---|
| PubChem CID | 138379964 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 5-ethyl-3-(2-morpholin-4-yl-1,3-thiazol-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazine |
| SMILES | CCC1COCc2nnc(-c3csc(N4CCOCC4)n3)n21 |
| InChI | InChI=1S/C14H19N5O2S/c1-2-10-7-21-8-12-16-17-13(19(10)12)11-9-22-14(15-11)18-3-5-20-6-4-18/h9-10H,2-8H2,1H3 |
| InChIKey | SANBOMCSZBYADV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |