C18H25N5OS — CID 139599301
4-(4-spiro[5,7-dihydropyrrolo[2,1-c][1,2,4]triazole-6,1'-cycloheptane]-3-yl-1,3-thiazol-2-yl)morpholine (PubChem CID 139599301) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is 4-(4-spiro[5,7-dihydropyrrolo[2,1-c][1,2,4]triazole-6,1'-cycloheptane]-3-yl-1,3-thiazol-2-yl)morpholine.
| Compound Name | 4-(4-spiro[5,7-dihydropyrrolo[2,1-c][1,2,4]triazole-6,1'-cycloheptane]-3-yl-1,3-thiazol-2-yl)morpholine |
|---|---|
| PubChem CID | 139599301 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 4-(4-spiro[5,7-dihydropyrrolo[2,1-c][1,2,4]triazole-6,1'-cycloheptane]-3-yl-1,3-thiazol-2-yl)morpholine |
| SMILES | c1sc(N2CCOCC2)nc1-c1nnc2n1CC1(CCCCCC1)C2 |
| InChI | InChI=1S/C18H25N5OS/c1-2-4-6-18(5-3-1)11-15-20-21-16(23(15)13-18)14-12-25-17(19-14)22-7-9-24-10-8-22/h12H,1-11,13H2 |
| InChIKey | AYXXHAFLVWHKDP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |