C16H17N5OS — CID 166230979
4-[4-[1-(3-methylphenyl)triazol-4-yl]-1,3-thiazol-2-yl]morpholine (PubChem CID 166230979) has the molecular formula C16H17N5OS and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-[4-[1-(3-methylphenyl)triazol-4-yl]-1,3-thiazol-2-yl]morpholine.
| Compound Name | 4-[4-[1-(3-methylphenyl)triazol-4-yl]-1,3-thiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 166230979 |
| Molecular Formula | C16H17N5OS |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 4-[4-[1-(3-methylphenyl)triazol-4-yl]-1,3-thiazol-2-yl]morpholine |
| SMILES | Cc1cccc(-n2cc(-c3csc(N4CCOCC4)n3)nn2)c1 |
| InChI | InChI=1S/C16H17N5OS/c1-12-3-2-4-13(9-12)21-10-14(18-19-21)15-11-23-16(17-15)20-5-7-22-8-6-20/h2-4,9-11H,5-8H2,1H3 |
| InChIKey | ZBOIBGVTVYQNCT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |