C7H7NO2S — CID 155030529
4-propanoyl-1,3-thiazole-2-carbaldehyde (PubChem CID 155030529) has the molecular formula C7H7NO2S and a molecular weight of 169.21 g/mol. Its IUPAC name is 4-propanoyl-1,3-thiazole-2-carbaldehyde.
| Compound Name | 4-propanoyl-1,3-thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 155030529 |
| Molecular Formula | C7H7NO2S |
| Molecular Weight | 169.21 g/mol |
| Exact Mass | 169.02 |
| IUPAC Name | 4-propanoyl-1,3-thiazole-2-carbaldehyde |
| SMILES | CCC(=O)c1csc(C=O)n1 |
| InChI | InChI=1S/C7H7NO2S/c1-2-6(10)5-4-11-7(3-9)8-5/h3-4H,2H2,1H3 |
| InChIKey | HITMIQJNDQATIZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|