C7H8N2OS — CID 59217959
2-[(Z)-prop-1-enyl]-1,3-thiazole-4-carboxamide (PubChem CID 59217959) has the molecular formula C7H8N2OS and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-[(Z)-prop-1-enyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(Z)-prop-1-enyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59217959 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 2-[(Z)-prop-1-enyl]-1,3-thiazole-4-carboxamide |
| SMILES | C/C=C\c1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C7H8N2OS/c1-2-3-6-9-5(4-11-6)7(8)10/h2-4H,1H3,(H2,8,10)/b3-2- |
| InChIKey | OAHHQWSEILBQJF-IHWYPQMZSA-N |
| XLogP | 1.28 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |