C12H20N2OS — CID 163734386
2-[(2R,4R)-4,5-dimethylhexan-2-yl]-1,3-thiazole-4-carboxamide (PubChem CID 163734386) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 2-[(2R,4R)-4,5-dimethylhexan-2-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2R,4R)-4,5-dimethylhexan-2-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 163734386 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2-[(2R,4R)-4,5-dimethylhexan-2-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)[C@H](C)C[C@@H](C)c1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C12H20N2OS/c1-7(2)8(3)5-9(4)12-14-10(6-16-12)11(13)15/h6-9H,5H2,1-4H3,(H2,13,15)/t8-,9-/m1/s1 |
| InChIKey | LCIFZNYHIOLSKI-RKDXNWHRSA-N |
| XLogP | 3.03 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |