C9H15N3OS — CID 68749134
2-[(1S,2S)-1-amino-2-methylbutyl]-1,3-thiazole-4-carboxamide (PubChem CID 68749134) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-[(1S,2S)-1-amino-2-methylbutyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(1S,2S)-1-amino-2-methylbutyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 68749134 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-[(1S,2S)-1-amino-2-methylbutyl]-1,3-thiazole-4-carboxamide |
| SMILES | CC[C@H](C)[C@H](N)c1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C9H15N3OS/c1-3-5(2)7(10)9-12-6(4-14-9)8(11)13/h4-5,7H,3,10H2,1-2H3,(H2,11,13)/t5-,7-/m0/s1 |
| InChIKey | NMFGNNDSUXCYHQ-FSPLSTOPSA-N |
| XLogP | 1.29 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |