C9H13N3O2S — CID 173107724
2-[(2R)-4-amino-2-methyl-4-oxobutyl]-1,3-thiazole-4-carboxamide (PubChem CID 173107724) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is 2-[(2R)-4-amino-2-methyl-4-oxobutyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2R)-4-amino-2-methyl-4-oxobutyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 173107724 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-[(2R)-4-amino-2-methyl-4-oxobutyl]-1,3-thiazole-4-carboxamide |
| SMILES | C[C@H](CC(N)=O)Cc1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C9H13N3O2S/c1-5(2-7(10)13)3-8-12-6(4-15-8)9(11)14/h4-5H,2-3H2,1H3,(H2,10,13)(H2,11,14)/t5-/m1/s1 |
| InChIKey | KUZBTPZNMPXPEO-RXMQYKEDSA-N |
| XLogP | 0.30 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |