C8H10N2O3S — CID 77050763
2-[(E,3S)-3,4-dihydroxybut-1-enyl]-1,3-thiazole-4-carboxamide (PubChem CID 77050763) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is 2-[(E,3S)-3,4-dihydroxybut-1-enyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(E,3S)-3,4-dihydroxybut-1-enyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 77050763 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-[(E,3S)-3,4-dihydroxybut-1-enyl]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(/C=C/[C@H](O)CO)n1 |
| InChI | InChI=1S/C8H10N2O3S/c9-8(13)6-4-14-7(10-6)2-1-5(12)3-11/h1-2,4-5,11-12H,3H2,(H2,9,13)/b2-1+/t5-/m0/s1 |
| InChIKey | JPXCLAVHRWPZLD-WYPBCBNTSA-N |
| XLogP | -0.39 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |