C11H9FN4O2S — CID 16949036
2-[(4-fluorophenyl)carbamoylamino]-1,3-thiazole-4-carboxamide (PubChem CID 16949036) has the molecular formula C11H9FN4O2S and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)carbamoylamino]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(4-fluorophenyl)carbamoylamino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16949036 |
| Molecular Formula | C11H9FN4O2S |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-[(4-fluorophenyl)carbamoylamino]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(NC(=O)Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C11H9FN4O2S/c12-6-1-3-7(4-2-6)14-10(18)16-11-15-8(5-19-11)9(13)17/h1-5H,(H2,13,17)(H2,14,15,16,18) |
| InChIKey | WCOVWXFJRFDQFZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |