C14H19BN2O2S — CID 145466222
ethyl 2-[(E)-3-[cyano(methyl)boranyl]-4-methylpent-1-enyl]-1,3-thiazole-4-carboxylate (PubChem CID 145466222) has the molecular formula C14H19BN2O2S and a molecular weight of 290.20 g/mol. Its IUPAC name is ethyl 2-[(E)-3-[cyano(methyl)boranyl]-4-methylpent-1-enyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(E)-3-[cyano(methyl)boranyl]-4-methylpent-1-enyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 145466222 |
| Molecular Formula | C14H19BN2O2S |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | ethyl 2-[(E)-3-[cyano(methyl)boranyl]-4-methylpent-1-enyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(/C=C/C(B(C)C#N)C(C)C)n1 |
| InChI | InChI=1S/C14H19BN2O2S/c1-5-19-14(18)12-8-20-13(17-12)7-6-11(10(2)3)15(4)9-16/h6-8,10-11H,5H2,1-4H3/b7-6+ |
| InChIKey | URWACOMJOWKXTR-VOTSOKGWSA-N |
| XLogP | 3.55 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|