C14H14N2O3S — CID 11543841
N-benzyl-1-(4-ethoxycarbonyl-1,3-thiazol-2-yl)methanimine oxide (PubChem CID 11543841) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is N-benzyl-1-(4-ethoxycarbonyl-1,3-thiazol-2-yl)methanimine oxide.
| Compound Name | N-benzyl-1-(4-ethoxycarbonyl-1,3-thiazol-2-yl)methanimine oxide |
|---|---|
| PubChem CID | 11543841 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-benzyl-1-(4-ethoxycarbonyl-1,3-thiazol-2-yl)methanimine oxide |
| SMILES | CCOC(=O)c1csc(/C=[N+](\[O-])Cc2ccccc2)n1 |
| InChI | InChI=1S/C14H14N2O3S/c1-2-19-14(17)12-10-20-13(15-12)9-16(18)8-11-6-4-3-5-7-11/h3-7,9-10H,2,8H2,1H3/b16-9- |
| InChIKey | GFQFADUQWCVTAU-SXGWCWSVSA-N |
| XLogP | 2.45 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|