About 4-ethynyl-1,3-thiazole-2-carbaldehyde
4-ethynyl-1,3-thiazole-2-carbaldehyde (PubChem CID 87782990) has the molecular formula C6H3NOS
and a molecular weight of 137.16 g/mol. Its IUPAC name is 4-ethynyl-1,3-thiazole-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-ethynyl-1,3-thiazole-2-carbaldehyde |
| PubChem CID | 87782990 |
| Molecular Formula | C6H3NOS |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 136.99 |
| IUPAC Name | 4-ethynyl-1,3-thiazole-2-carbaldehyde |
| SMILES | C#Cc1csc(C=O)n1 |
| InChI | InChI=1S/C6H3NOS/c1-2-5-4-9-6(3-8)7-5/h1,3-4H |
| InChIKey | USIJRYJQSFSWSD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-1,3-thiazole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-1,3-thiazole-2-carbaldehyde?
The IUPAC name of 4-ethynyl-1,3-thiazole-2-carbaldehyde (CID 87782990) is 4-ethynyl-1,3-thiazole-2-carbaldehyde.
What is the SMILES notation for 4-ethynyl-1,3-thiazole-2-carbaldehyde?
The canonical SMILES for 4-ethynyl-1,3-thiazole-2-carbaldehyde is C#Cc1csc(C=O)n1.
What is the InChIKey of 4-ethynyl-1,3-thiazole-2-carbaldehyde?
The InChIKey is USIJRYJQSFSWSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3NOS/c1-2-5-4-9-6(3-8)7-5/h1,3-4H.
What are the key properties of 4-ethynyl-1,3-thiazole-2-carbaldehyde?
4-ethynyl-1,3-thiazole-2-carbaldehyde has a molecular weight of 137.16 g/mol, XLogP of 0.94, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-1,3-thiazole-2-carbaldehyde is sourced from PubChem (CID 87782990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).