C10H13NO — CID 20718452
1-(4,6-dimethyl-2-pyridinyl)propan-1-one (PubChem CID 20718452) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-(4,6-dimethyl-2-pyridinyl)propan-1-one.
| Compound Name | 1-(4,6-dimethyl-2-pyridinyl)propan-1-one |
|---|---|
| PubChem CID | 20718452 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1-(4,6-dimethyl-2-pyridinyl)propan-1-one |
| SMILES | CCC(=O)c1cc(C)cc(C)n1 |
| InChI | InChI=1S/C10H13NO/c1-4-10(12)9-6-7(2)5-8(3)11-9/h5-6H,4H2,1-3H3 |
| InChIKey | BWEXMOKYGGOMQV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |