About 1-(2-bromo-1,3-thiazol-4-yl)hexane-1,4-dione
1-(2-bromo-1,3-thiazol-4-yl)hexane-1,4-dione (PubChem CID 171792963) has the molecular formula C9H10BrNO2S
and a molecular weight of 276.15 g/mol. Its IUPAC name is 1-(2-bromo-1,3-thiazol-4-yl)hexane-1,4-dione.
Molecular Properties
| Compound Name | 1-(2-bromo-1,3-thiazol-4-yl)hexane-1,4-dione |
| PubChem CID | 171792963 |
| Molecular Formula | C9H10BrNO2S |
| Molecular Weight | 276.15 g/mol |
| Exact Mass | 274.96 |
| IUPAC Name | 1-(2-bromo-1,3-thiazol-4-yl)hexane-1,4-dione |
| SMILES | CCC(=O)CCC(=O)c1csc(Br)n1 |
| InChI | InChI=1S/C9H10BrNO2S/c1-2-6(12)3-4-8(13)7-5-14-9(10)11-7/h5H,2-4H2,1H3 |
| InChIKey | WTYGNOHIMYYVIQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.15 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-bromo-1,3-thiazol-4-yl)hexane-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromo-1,3-thiazol-4-yl)hexane-1,4-dione?
The IUPAC name of 1-(2-bromo-1,3-thiazol-4-yl)hexane-1,4-dione (CID 171792963) is 1-(2-bromo-1,3-thiazol-4-yl)hexane-1,4-dione.
What is the SMILES notation for 1-(2-bromo-1,3-thiazol-4-yl)hexane-1,4-dione?
The canonical SMILES for 1-(2-bromo-1,3-thiazol-4-yl)hexane-1,4-dione is CCC(=O)CCC(=O)c1csc(Br)n1.
What is the InChIKey of 1-(2-bromo-1,3-thiazol-4-yl)hexane-1,4-dione?
The InChIKey is WTYGNOHIMYYVIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO2S/c1-2-6(12)3-4-8(13)7-5-14-9(10)11-7/h5H,2-4H2,1H3.
What are the key properties of 1-(2-bromo-1,3-thiazol-4-yl)hexane-1,4-dione?
1-(2-bromo-1,3-thiazol-4-yl)hexane-1,4-dione has a molecular weight of 276.15 g/mol, XLogP of 2.85, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromo-1,3-thiazol-4-yl)hexane-1,4-dione is sourced from PubChem (CID 171792963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).