C12H12F3NOS — CID 170480494
S-[4-[4-(trifluoromethyl)-2-pyridinyl]but-3-enyl] ethanethioate (PubChem CID 170480494) has the molecular formula C12H12F3NOS and a molecular weight of 275.30 g/mol. Its IUPAC name is S-[4-[4-(trifluoromethyl)-2-pyridinyl]but-3-enyl] ethanethioate.
| Compound Name | S-[4-[4-(trifluoromethyl)-2-pyridinyl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480494 |
| Molecular Formula | C12H12F3NOS |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | S-[4-[4-(trifluoromethyl)-2-pyridinyl]but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C12H12F3NOS/c1-9(17)18-7-3-2-4-11-8-10(5-6-16-11)12(13,14)15/h2,4-6,8H,3,7H2,1H3 |
| InChIKey | WKUCZPBTEUOZPF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|