About 4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enoic acid
4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enoic acid (PubChem CID 170483082) has the molecular formula C8H9NO3S
and a molecular weight of 199.23 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enoic acid.
Analyze 4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enoic acid?
The IUPAC name of 4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enoic acid (CID 170483082) is 4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enoic acid.
What is the SMILES notation for 4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enoic acid?
The canonical SMILES for 4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enoic acid is O=C(O)CC=Cc1nc(CO)cs1.
What is the InChIKey of 4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enoic acid?
The InChIKey is KIPAKBWJRMJYHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3S/c10-4-6-5-13-7(9-6)2-1-3-8(11)12/h1-2,5,10H,3-4H2,(H,11,12).
What are the key properties of 4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enoic acid?
4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enoic acid has a molecular weight of 199.23 g/mol, XLogP of 1.12, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-enoic acid is sourced from PubChem (CID 170483082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).