C7H6N2OS — CID 169483059
3-[4-(hydroxymethyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 169483059) has the molecular formula C7H6N2OS and a molecular weight of 166.21 g/mol. Its IUPAC name is 3-[4-(hydroxymethyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-[4-(hydroxymethyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 169483059 |
| Molecular Formula | C7H6N2OS |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 3-[4-(hydroxymethyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#CC=Cc1nc(CO)cs1 |
| InChI | InChI=1S/C7H6N2OS/c8-3-1-2-7-9-6(4-10)5-11-7/h1-2,5,10H,4H2 |
| InChIKey | LZNOGOLVVQGKBF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|