C20H34O6S4 — CID 130277170
diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate (PubChem CID 130277170) has the molecular formula C20H34O6S4 and a molecular weight of 498.75 g/mol. Its IUPAC name is diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate.
| Compound Name | diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate |
|---|---|
| PubChem CID | 130277170 |
| Molecular Formula | C20H34O6S4 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate |
| SMILES | CCOC(=O)CCC(CCC(CCC(=O)OCC)SC(=S)OCC)SC(=S)OCC |
| InChI | InChI=1S/C20H34O6S4/c1-5-23-17(21)13-11-15(29-19(27)25-7-3)9-10-16(30-20(28)26-8-4)12-14-18(22)24-6-2/h15-16H,5-14H2,1-4H3 |
| InChIKey | MGDPVDGEISFCLO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|