C18H17N2O5P — CID 130277434
[4-[(3aS)-3a-hydroxy-6-methyl-4-oxo-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl]phenyl]phosphonic acid (PubChem CID 130277434) has the molecular formula C18H17N2O5P and a molecular weight of 372.32 g/mol. Its IUPAC name is [4-[(3aS)-3a-hydroxy-6-methyl-4-oxo-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl]phenyl]phosphonic acid.
| Compound Name | [4-[(3aS)-3a-hydroxy-6-methyl-4-oxo-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 130277434 |
| Molecular Formula | C18H17N2O5P |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [4-[(3aS)-3a-hydroxy-6-methyl-4-oxo-2,3-dihydropyrrolo[2,3-b]quinolin-1-yl]phenyl]phosphonic acid |
| SMILES | Cc1ccc2c(c1)C(=O)[C@]1(O)CCN(c3ccc(P(=O)(O)O)cc3)C1=N2 |
| InChI | InChI=1S/C18H17N2O5P/c1-11-2-7-15-14(10-11)16(21)18(22)8-9-20(17(18)19-15)12-3-5-13(6-4-12)26(23,24)25/h2-7,10,22H,8-9H2,1H3,(H2,23,24,25)/t18-/m1/s1 |
| InChIKey | OZRAJQWVKYQYJS-GOSISDBHSA-N |
| XLogP | 1.67 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|