C13H26N2O2 — CID 130279567
N-(2-amino-2-oxoethyl)-2,2-dimethyl-N-propylhexanamide (PubChem CID 130279567) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2,2-dimethyl-N-propylhexanamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2,2-dimethyl-N-propylhexanamide |
|---|---|
| PubChem CID | 130279567 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2,2-dimethyl-N-propylhexanamide |
| SMILES | CCCCC(C)(C)C(=O)N(CCC)CC(N)=O |
| InChI | InChI=1S/C13H26N2O2/c1-5-7-8-13(3,4)12(17)15(9-6-2)10-11(14)16/h5-10H2,1-4H3,(H2,14,16) |
| InChIKey | FGYLJOHFXFTFGQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |