C8H14N4 — CID 130280061
1-(3-amino-4-pyridinyl)-N-methylethane-1,2-diamine (PubChem CID 130280061) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 1-(3-amino-4-pyridinyl)-N-methylethane-1,2-diamine.
| Compound Name | 1-(3-amino-4-pyridinyl)-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 130280061 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 1-(3-amino-4-pyridinyl)-N-methylethane-1,2-diamine |
| SMILES | CNC(CN)c1ccncc1N |
| InChI | InChI=1S/C8H14N4/c1-11-8(4-9)6-2-3-12-5-7(6)10/h2-3,5,8,11H,4,9-10H2,1H3 |
| InChIKey | FZXKEVJEQAPXHG-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |