C10H18N4 — CID 90212207
3-(3-amino-4-pyridinyl)pentane-1,4-diamine (PubChem CID 90212207) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-(3-amino-4-pyridinyl)pentane-1,4-diamine.
| Compound Name | 3-(3-amino-4-pyridinyl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 90212207 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 3-(3-amino-4-pyridinyl)pentane-1,4-diamine |
| SMILES | CC(N)C(CCN)c1ccncc1N |
| InChI | InChI=1S/C10H18N4/c1-7(12)8(2-4-11)9-3-5-14-6-10(9)13/h3,5-8H,2,4,11-13H2,1H3 |
| InChIKey | IQTALEGOASODMD-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |