C24H35N3O3 — CID 130280624
tert-butyl N-[(2S)-7-[[1-cyano-2-(4-prop-1-en-2-ylphenyl)ethyl]amino]-7-oxoheptan-2-yl]carbamate (PubChem CID 130280624) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is tert-butyl N-[(2S)-7-[[1-cyano-2-(4-prop-1-en-2-ylphenyl)ethyl]amino]-7-oxoheptan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-7-[[1-cyano-2-(4-prop-1-en-2-ylphenyl)ethyl]amino]-7-oxoheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 130280624 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | tert-butyl N-[(2S)-7-[[1-cyano-2-(4-prop-1-en-2-ylphenyl)ethyl]amino]-7-oxoheptan-2-yl]carbamate |
| SMILES | C=C(C)c1ccc(CC(C#N)NC(=O)CCCC[C@H](C)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H35N3O3/c1-17(2)20-13-11-19(12-14-20)15-21(16-25)27-22(28)10-8-7-9-18(3)26-23(29)30-24(4,5)6/h11-14,18,21H,1,7-10,15H2,2-6H3,(H,26,29)(H,27,28)/t18-,21?/m0/s1 |
| InChIKey | SWHUCEHSWRBNQX-YMXDCFFPSA-N |
| XLogP | 4.74 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|