C17H14ClF6N5O2 — CID 130281683
1-[3-chloro-6-cyclopropyl-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carbonyl]-4-(2,2,2-trifluoroethyl)-1,2,4-triazinan-3-one (PubChem CID 130281683) has the molecular formula C17H14ClF6N5O2 and a molecular weight of 469.77 g/mol. Its IUPAC name is 1-[3-chloro-6-cyclopropyl-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carbonyl]-4-(2,2,2-trifluoroethyl)-1,2,4-triazinan-3-one.
| Compound Name | 1-[3-chloro-6-cyclopropyl-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carbonyl]-4-(2,2,2-trifluoroethyl)-1,2,4-triazinan-3-one |
|---|---|
| PubChem CID | 130281683 |
| Molecular Formula | C17H14ClF6N5O2 |
| Molecular Weight | 469.77 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 1-[3-chloro-6-cyclopropyl-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carbonyl]-4-(2,2,2-trifluoroethyl)-1,2,4-triazinan-3-one |
| SMILES | O=C1NN(C(=O)c2nc3c(C(F)(F)F)cc(C4CC4)cn3c2Cl)CCN1CC(F)(F)F |
| InChI | InChI=1S/C17H14ClF6N5O2/c18-12-11(14(30)29-4-3-27(15(31)26-29)7-16(19,20)21)25-13-10(17(22,23)24)5-9(6-28(12)13)8-1-2-8/h5-6,8H,1-4,7H2,(H,26,31) |
| InChIKey | JZUBJQGVJQPMDQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |