C21H25F3N6O2 — CID 130284728
1-[(1S,4S)-4-(3-hydroxy-3-methylazetidin-1-yl)-2-iminocyclohexyl]-3-[4-(trifluoromethyl)anilino]pyrazole-4-carboxamide (PubChem CID 130284728) has the molecular formula C21H25F3N6O2 and a molecular weight of 450.47 g/mol. Its IUPAC name is 1-[(1S,4S)-4-(3-hydroxy-3-methylazetidin-1-yl)-2-iminocyclohexyl]-3-[4-(trifluoromethyl)anilino]pyrazole-4-carboxamide.
| Compound Name | 1-[(1S,4S)-4-(3-hydroxy-3-methylazetidin-1-yl)-2-iminocyclohexyl]-3-[4-(trifluoromethyl)anilino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 130284728 |
| Molecular Formula | C21H25F3N6O2 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 1-[(1S,4S)-4-(3-hydroxy-3-methylazetidin-1-yl)-2-iminocyclohexyl]-3-[4-(trifluoromethyl)anilino]pyrazole-4-carboxamide |
| SMILES | [H]/N=C1\C[C@@H](N2CC(C)(O)C2)CC[C@@H]1n1cc(C(N)=O)c(Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C21H25F3N6O2/c1-20(32)10-29(11-20)14-6-7-17(16(25)8-14)30-9-15(18(26)31)19(28-30)27-13-4-2-12(3-5-13)21(22,23)24/h2-5,9,14,17,25,32H,6-8,10-11H2,1H3,(H2,26,31)(H,27,28)/b25-16+/t14-,17-/m0/s1 |
| InChIKey | RTGUTPXQSVTHNH-FRCINEKYSA-N |
| XLogP | 2.92 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|