C24H29F3N6O2 — CID 144556304
1-[(2S,4S)-2-cyano-4-(3,3-dimethylazetidin-1-yl)cyclohexyl]-3-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]anilino]pyrazole-4-carboxamide (PubChem CID 144556304) has the molecular formula C24H29F3N6O2 and a molecular weight of 490.53 g/mol. Its IUPAC name is 1-[(2S,4S)-2-cyano-4-(3,3-dimethylazetidin-1-yl)cyclohexyl]-3-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]anilino]pyrazole-4-carboxamide.
| Compound Name | 1-[(2S,4S)-2-cyano-4-(3,3-dimethylazetidin-1-yl)cyclohexyl]-3-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]anilino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 144556304 |
| Molecular Formula | C24H29F3N6O2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 1-[(2S,4S)-2-cyano-4-(3,3-dimethylazetidin-1-yl)cyclohexyl]-3-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]anilino]pyrazole-4-carboxamide |
| SMILES | CC1(C)CN([C@H]2CCC(n3cc(C(N)=O)c(Nc4ccc([C@@H](O)C(F)(F)F)cc4)n3)[C@@H](C#N)C2)C1 |
| InChI | InChI=1S/C24H29F3N6O2/c1-23(2)12-32(13-23)17-7-8-19(15(9-17)10-28)33-11-18(21(29)35)22(31-33)30-16-5-3-14(4-6-16)20(34)24(25,26)27/h3-6,11,15,17,19-20,34H,7-9,12-13H2,1-2H3,(H2,29,35)(H,30,31)/t15-,17+,19?,20-/m1/s1 |
| InChIKey | JLEJGZVOCPVIIQ-BJTUYJOVSA-N |
| XLogP | 3.90 |
| TPSA | 120.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |